C15H27N3O2 — CID 79495031
3-[2,2-diethoxy-1-(propylamino)ethyl]-5-methylpyridin-2-amine (PubChem CID 79495031) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is 3-[2,2-diethoxy-1-(propylamino)ethyl]-5-methylpyridin-2-amine.
| Compound Name | 3-[2,2-diethoxy-1-(propylamino)ethyl]-5-methylpyridin-2-amine |
|---|---|
| PubChem CID | 79495031 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 3-[2,2-diethoxy-1-(propylamino)ethyl]-5-methylpyridin-2-amine |
| SMILES | CCCNC(c1cc(C)cnc1N)C(OCC)OCC |
| InChI | InChI=1S/C15H27N3O2/c1-5-8-17-13(15(19-6-2)20-7-3)12-9-11(4)10-18-14(12)16/h9-10,13,15,17H,5-8H2,1-4H3,(H2,16,18) |
| InChIKey | WUWLDECWLKYTCR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|