C18H31N3 — CID 80610949
3-[cyclooctyl(propylamino)methyl]-5-methylpyridin-2-amine (PubChem CID 80610949) has the molecular formula C18H31N3 and a molecular weight of 289.47 g/mol. Its IUPAC name is 3-[cyclooctyl(propylamino)methyl]-5-methylpyridin-2-amine.
| Compound Name | 3-[cyclooctyl(propylamino)methyl]-5-methylpyridin-2-amine |
|---|---|
| PubChem CID | 80610949 |
| Molecular Formula | C18H31N3 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.25 |
| IUPAC Name | 3-[cyclooctyl(propylamino)methyl]-5-methylpyridin-2-amine |
| SMILES | CCCNC(c1cc(C)cnc1N)C1CCCCCCC1 |
| InChI | InChI=1S/C18H31N3/c1-3-11-20-17(15-9-7-5-4-6-8-10-15)16-12-14(2)13-21-18(16)19/h12-13,15,17,20H,3-11H2,1-2H3,(H2,19,21) |
| InChIKey | UWUQCUOIQXAKIB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |