C17H29N3S — CID 65144255
3-[2-cyclohexylsulfanyl-1-(propylamino)ethyl]-5-methylpyridin-2-amine (PubChem CID 65144255) has the molecular formula C17H29N3S and a molecular weight of 307.51 g/mol. Its IUPAC name is 3-[2-cyclohexylsulfanyl-1-(propylamino)ethyl]-5-methylpyridin-2-amine.
| Compound Name | 3-[2-cyclohexylsulfanyl-1-(propylamino)ethyl]-5-methylpyridin-2-amine |
|---|---|
| PubChem CID | 65144255 |
| Molecular Formula | C17H29N3S |
| Molecular Weight | 307.51 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 3-[2-cyclohexylsulfanyl-1-(propylamino)ethyl]-5-methylpyridin-2-amine |
| SMILES | CCCNC(CSC1CCCCC1)c1cc(C)cnc1N |
| InChI | InChI=1S/C17H29N3S/c1-3-9-19-16(12-21-14-7-5-4-6-8-14)15-10-13(2)11-20-17(15)18/h10-11,14,16,19H,3-9,12H2,1-2H3,(H2,18,20) |
| InChIKey | MLYQIJUKGRXWFL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |