C15H25N3S — CID 65144541
3-[2-cyclohexylsulfanyl-1-(ethylamino)ethyl]pyridin-2-amine (PubChem CID 65144541) has the molecular formula C15H25N3S and a molecular weight of 279.45 g/mol. Its IUPAC name is 3-[2-cyclohexylsulfanyl-1-(ethylamino)ethyl]pyridin-2-amine.
| Compound Name | 3-[2-cyclohexylsulfanyl-1-(ethylamino)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 65144541 |
| Molecular Formula | C15H25N3S |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 3-[2-cyclohexylsulfanyl-1-(ethylamino)ethyl]pyridin-2-amine |
| SMILES | CCNC(CSC1CCCCC1)c1cccnc1N |
| InChI | InChI=1S/C15H25N3S/c1-2-17-14(13-9-6-10-18-15(13)16)11-19-12-7-4-3-5-8-12/h6,9-10,12,14,17H,2-5,7-8,11H2,1H3,(H2,16,18) |
| InChIKey | AJGXYEJOXXGIDH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |