C14H23N3S — CID 65144630
3-[2-cyclohexylsulfanyl-1-(methylamino)ethyl]pyridin-2-amine (PubChem CID 65144630) has the molecular formula C14H23N3S and a molecular weight of 265.43 g/mol. Its IUPAC name is 3-[2-cyclohexylsulfanyl-1-(methylamino)ethyl]pyridin-2-amine.
| Compound Name | 3-[2-cyclohexylsulfanyl-1-(methylamino)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 65144630 |
| Molecular Formula | C14H23N3S |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 3-[2-cyclohexylsulfanyl-1-(methylamino)ethyl]pyridin-2-amine |
| SMILES | CNC(CSC1CCCCC1)c1cccnc1N |
| InChI | InChI=1S/C14H23N3S/c1-16-13(12-8-5-9-17-14(12)15)10-18-11-6-3-2-4-7-11/h5,8-9,11,13,16H,2-4,6-7,10H2,1H3,(H2,15,17) |
| InChIKey | XSNSKKDVACLYTF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |