C14H24ClN3O2 — CID 102928686
5-chloro-3-[3-(2-methoxyethoxy)-1-(propylamino)propyl]pyridin-2-amine (PubChem CID 102928686) has the molecular formula C14H24ClN3O2 and a molecular weight of 301.82 g/mol. Its IUPAC name is 5-chloro-3-[3-(2-methoxyethoxy)-1-(propylamino)propyl]pyridin-2-amine.
| Compound Name | 5-chloro-3-[3-(2-methoxyethoxy)-1-(propylamino)propyl]pyridin-2-amine |
|---|---|
| PubChem CID | 102928686 |
| Molecular Formula | C14H24ClN3O2 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 5-chloro-3-[3-(2-methoxyethoxy)-1-(propylamino)propyl]pyridin-2-amine |
| SMILES | CCCNC(CCOCCOC)c1cc(Cl)cnc1N |
| InChI | InChI=1S/C14H24ClN3O2/c1-3-5-17-13(4-6-20-8-7-19-2)12-9-11(15)10-18-14(12)16/h9-10,13,17H,3-8H2,1-2H3,(H2,16,18) |
| InChIKey | KUKMTVRKTXQUHQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|