C9H15ClN4O — CID 105206436
5-chloro-3-(1-hydrazinyl-3-methoxypropyl)pyridin-2-amine (PubChem CID 105206436) has the molecular formula C9H15ClN4O and a molecular weight of 230.70 g/mol. Its IUPAC name is 5-chloro-3-(1-hydrazinyl-3-methoxypropyl)pyridin-2-amine.
| Compound Name | 5-chloro-3-(1-hydrazinyl-3-methoxypropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 105206436 |
| Molecular Formula | C9H15ClN4O |
| Molecular Weight | 230.70 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 5-chloro-3-(1-hydrazinyl-3-methoxypropyl)pyridin-2-amine |
| SMILES | COCCC(NN)c1cc(Cl)cnc1N |
| InChI | InChI=1S/C9H15ClN4O/c1-15-3-2-8(14-12)7-4-6(10)5-13-9(7)11/h4-5,8,14H,2-3,12H2,1H3,(H2,11,13) |
| InChIKey | WSBXTPPHODDFHB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.70 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|