C11H19ClN4O — CID 105274490
5-chloro-3-(1-hydrazinyl-2-methoxy-2-methylbutyl)pyridin-2-amine (PubChem CID 105274490) has the molecular formula C11H19ClN4O and a molecular weight of 258.75 g/mol. Its IUPAC name is 5-chloro-3-(1-hydrazinyl-2-methoxy-2-methylbutyl)pyridin-2-amine.
| Compound Name | 5-chloro-3-(1-hydrazinyl-2-methoxy-2-methylbutyl)pyridin-2-amine |
|---|---|
| PubChem CID | 105274490 |
| Molecular Formula | C11H19ClN4O |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 5-chloro-3-(1-hydrazinyl-2-methoxy-2-methylbutyl)pyridin-2-amine |
| SMILES | CCC(C)(OC)C(NN)c1cc(Cl)cnc1N |
| InChI | InChI=1S/C11H19ClN4O/c1-4-11(2,17-3)9(16-14)8-5-7(12)6-15-10(8)13/h5-6,9,16H,4,14H2,1-3H3,(H2,13,15) |
| InChIKey | UZGTXRNLYNXKIA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|