C13H22ClN5 — CID 105239648
5-chloro-3-(1-hydrazinyl-2-methyl-2-pyrrolidin-1-ylpropyl)pyridin-2-amine (PubChem CID 105239648) has the molecular formula C13H22ClN5 and a molecular weight of 283.81 g/mol. Its IUPAC name is 5-chloro-3-(1-hydrazinyl-2-methyl-2-pyrrolidin-1-ylpropyl)pyridin-2-amine.
| Compound Name | 5-chloro-3-(1-hydrazinyl-2-methyl-2-pyrrolidin-1-ylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 105239648 |
| Molecular Formula | C13H22ClN5 |
| Molecular Weight | 283.81 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 5-chloro-3-(1-hydrazinyl-2-methyl-2-pyrrolidin-1-ylpropyl)pyridin-2-amine |
| SMILES | CC(C)(C(NN)c1cc(Cl)cnc1N)N1CCCC1 |
| InChI | InChI=1S/C13H22ClN5/c1-13(2,19-5-3-4-6-19)11(18-16)10-7-9(14)8-17-12(10)15/h7-8,11,18H,3-6,16H2,1-2H3,(H2,15,17) |
| InChIKey | HUQBERWMLRJYQN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.81 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|