C15H26ClN5 — CID 105243865
5-chloro-3-[[1-(dimethylamino)cycloheptyl]-hydrazinylmethyl]pyridin-2-amine (PubChem CID 105243865) has the molecular formula C15H26ClN5 and a molecular weight of 311.86 g/mol. Its IUPAC name is 5-chloro-3-[[1-(dimethylamino)cycloheptyl]-hydrazinylmethyl]pyridin-2-amine.
| Compound Name | 5-chloro-3-[[1-(dimethylamino)cycloheptyl]-hydrazinylmethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 105243865 |
| Molecular Formula | C15H26ClN5 |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 5-chloro-3-[[1-(dimethylamino)cycloheptyl]-hydrazinylmethyl]pyridin-2-amine |
| SMILES | CN(C)C1(C(NN)c2cc(Cl)cnc2N)CCCCCC1 |
| InChI | InChI=1S/C15H26ClN5/c1-21(2)15(7-5-3-4-6-8-15)13(20-18)12-9-11(16)10-19-14(12)17/h9-10,13,20H,3-8,18H2,1-2H3,(H2,17,19) |
| InChIKey | SMGOHGDJVGRFHZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|