C10H17ClN4 — CID 105245743
5-chloro-3-(1-hydrazinylpentyl)pyridin-2-amine (PubChem CID 105245743) has the molecular formula C10H17ClN4 and a molecular weight of 228.73 g/mol. Its IUPAC name is 5-chloro-3-(1-hydrazinylpentyl)pyridin-2-amine.
| Compound Name | 5-chloro-3-(1-hydrazinylpentyl)pyridin-2-amine |
|---|---|
| PubChem CID | 105245743 |
| Molecular Formula | C10H17ClN4 |
| Molecular Weight | 228.73 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 5-chloro-3-(1-hydrazinylpentyl)pyridin-2-amine |
| SMILES | CCCCC(NN)c1cc(Cl)cnc1N |
| InChI | InChI=1S/C10H17ClN4/c1-2-3-4-9(15-13)8-5-7(11)6-14-10(8)12/h5-6,9,15H,2-4,13H2,1H3,(H2,12,14) |
| InChIKey | LXAUENSIUADSFE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.73 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|