C12H20ClN3O — CID 64532990
5-chloro-3-[2-ethoxy-1-(ethylamino)propyl]pyridin-2-amine (PubChem CID 64532990) has the molecular formula C12H20ClN3O and a molecular weight of 257.76 g/mol. Its IUPAC name is 5-chloro-3-[2-ethoxy-1-(ethylamino)propyl]pyridin-2-amine.
| Compound Name | 5-chloro-3-[2-ethoxy-1-(ethylamino)propyl]pyridin-2-amine |
|---|---|
| PubChem CID | 64532990 |
| Molecular Formula | C12H20ClN3O |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 5-chloro-3-[2-ethoxy-1-(ethylamino)propyl]pyridin-2-amine |
| SMILES | CCNC(c1cc(Cl)cnc1N)C(C)OCC |
| InChI | InChI=1S/C12H20ClN3O/c1-4-15-11(8(3)17-5-2)10-6-9(13)7-16-12(10)14/h6-8,11,15H,4-5H2,1-3H3,(H2,14,16) |
| InChIKey | UOZINOISWFVLQI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |