C9H14ClN3O — CID 79615951
3-(1-amino-2-methoxypropyl)-5-chloropyridin-2-amine (PubChem CID 79615951) has the molecular formula C9H14ClN3O and a molecular weight of 215.68 g/mol. Its IUPAC name is 3-(1-amino-2-methoxypropyl)-5-chloropyridin-2-amine.
| Compound Name | 3-(1-amino-2-methoxypropyl)-5-chloropyridin-2-amine |
|---|---|
| PubChem CID | 79615951 |
| Molecular Formula | C9H14ClN3O |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 3-(1-amino-2-methoxypropyl)-5-chloropyridin-2-amine |
| SMILES | COC(C)C(N)c1cc(Cl)cnc1N |
| InChI | InChI=1S/C9H14ClN3O/c1-5(14-2)8(11)7-3-6(10)4-13-9(7)12/h3-5,8H,11H2,1-2H3,(H2,12,13) |
| InChIKey | PCHAPXXNHWVBHP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |