C7H11ClN4 — CID 55273513
1-(2-amino-5-chloro-3-pyridinyl)ethane-1,2-diamine (PubChem CID 55273513) has the molecular formula C7H11ClN4 and a molecular weight of 186.65 g/mol. Its IUPAC name is 1-(2-amino-5-chloro-3-pyridinyl)ethane-1,2-diamine.
| Compound Name | 1-(2-amino-5-chloro-3-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 55273513 |
| Molecular Formula | C7H11ClN4 |
| Molecular Weight | 186.65 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 1-(2-amino-5-chloro-3-pyridinyl)ethane-1,2-diamine |
| SMILES | NCC(N)c1cc(Cl)cnc1N |
| InChI | InChI=1S/C7H11ClN4/c8-4-1-5(6(10)2-9)7(11)12-3-4/h1,3,6H,2,9-10H2,(H2,11,12) |
| InChIKey | IYNCFZWALRFDKG-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.65 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |