C7H10ClN3O — CID 130710939
(2R)-2-amino-2-(2-amino-5-chloro-3-pyridinyl)ethanol (PubChem CID 130710939) has the molecular formula C7H10ClN3O and a molecular weight of 187.63 g/mol. Its IUPAC name is (2R)-2-amino-2-(2-amino-5-chloro-3-pyridinyl)ethanol.
| Compound Name | (2R)-2-amino-2-(2-amino-5-chloro-3-pyridinyl)ethanol |
|---|---|
| PubChem CID | 130710939 |
| Molecular Formula | C7H10ClN3O |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | (2R)-2-amino-2-(2-amino-5-chloro-3-pyridinyl)ethanol |
| SMILES | Nc1ncc(Cl)cc1[C@@H](N)CO |
| InChI | InChI=1S/C7H10ClN3O/c8-4-1-5(6(9)3-12)7(10)11-2-4/h1-2,6,12H,3,9H2,(H2,10,11)/t6-/m0/s1 |
| InChIKey | HISIKJPHKIRXQW-LURJTMIESA-N |
| XLogP | 0.31 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |