C7H9ClFN3 — CID 55271248
(1R)-1-(5-chloro-2-fluoro-3-pyridinyl)ethane-1,2-diamine (PubChem CID 55271248) has the molecular formula C7H9ClFN3 and a molecular weight of 189.62 g/mol. Its IUPAC name is (1R)-1-(5-chloro-2-fluoro-3-pyridinyl)ethane-1,2-diamine.
| Compound Name | (1R)-1-(5-chloro-2-fluoro-3-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 55271248 |
| Molecular Formula | C7H9ClFN3 |
| Molecular Weight | 189.62 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | (1R)-1-(5-chloro-2-fluoro-3-pyridinyl)ethane-1,2-diamine |
| SMILES | NC[C@H](N)c1cc(Cl)cnc1F |
| InChI | InChI=1S/C7H9ClFN3/c8-4-1-5(6(11)2-10)7(9)12-3-4/h1,3,6H,2,10-11H2/t6-/m0/s1 |
| InChIKey | BDWZCKHXEDJODF-LURJTMIESA-N |
| XLogP | 0.83 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.62 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|