C8H12ClN3 — CID 55273502
1-(6-chloro-4-methyl-3-pyridinyl)ethane-1,2-diamine (PubChem CID 55273502) has the molecular formula C8H12ClN3 and a molecular weight of 185.66 g/mol. Its IUPAC name is 1-(6-chloro-4-methyl-3-pyridinyl)ethane-1,2-diamine.
| Compound Name | 1-(6-chloro-4-methyl-3-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 55273502 |
| Molecular Formula | C8H12ClN3 |
| Molecular Weight | 185.66 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 1-(6-chloro-4-methyl-3-pyridinyl)ethane-1,2-diamine |
| SMILES | Cc1cc(Cl)ncc1C(N)CN |
| InChI | InChI=1S/C8H12ClN3/c1-5-2-8(9)12-4-6(5)7(11)3-10/h2,4,7H,3,10-11H2,1H3 |
| InChIKey | PPTSJLVIUXIHMZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.66 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|