C7H11ClN4 — CID 131097721
(1R)-1-(5-amino-6-chloro-3-pyridinyl)ethane-1,2-diamine (PubChem CID 131097721) has the molecular formula C7H11ClN4 and a molecular weight of 186.65 g/mol. Its IUPAC name is (1R)-1-(5-amino-6-chloro-3-pyridinyl)ethane-1,2-diamine.
| Compound Name | (1R)-1-(5-amino-6-chloro-3-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 131097721 |
| Molecular Formula | C7H11ClN4 |
| Molecular Weight | 186.65 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | (1R)-1-(5-amino-6-chloro-3-pyridinyl)ethane-1,2-diamine |
| SMILES | NC[C@H](N)c1cnc(Cl)c(N)c1 |
| InChI | InChI=1S/C7H11ClN4/c8-7-5(10)1-4(3-12-7)6(11)2-9/h1,3,6H,2,9-11H2/t6-/m0/s1 |
| InChIKey | GUISMQUFMKLEJR-LURJTMIESA-N |
| XLogP | 0.28 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.65 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|