C8H10Cl2N2 — CID 66517114
(1R)-1-(3,5-dichlorophenyl)ethane-1,2-diamine (PubChem CID 66517114) has the molecular formula C8H10Cl2N2 and a molecular weight of 205.09 g/mol. Its IUPAC name is (1R)-1-(3,5-dichlorophenyl)ethane-1,2-diamine.
| Compound Name | (1R)-1-(3,5-dichlorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 66517114 |
| Molecular Formula | C8H10Cl2N2 |
| Molecular Weight | 205.09 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | (1R)-1-(3,5-dichlorophenyl)ethane-1,2-diamine |
| SMILES | NC[C@H](N)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C8H10Cl2N2/c9-6-1-5(8(12)4-11)2-7(10)3-6/h1-3,8H,4,11-12H2/t8-/m0/s1 |
| InChIKey | JLMCDYSDCCEFAP-QMMMGPOBSA-N |
| XLogP | 1.95 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.09 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |