C8H11Cl3N2O — CID 171224788
2,6-dichloro-4-[(1R)-1,2-diaminoethyl]phenol;hydrochloride (PubChem CID 171224788) has the molecular formula C8H11Cl3N2O and a molecular weight of 257.55 g/mol. Its IUPAC name is 2,6-dichloro-4-[(1R)-1,2-diaminoethyl]phenol;hydrochloride.
| Compound Name | 2,6-dichloro-4-[(1R)-1,2-diaminoethyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 171224788 |
| Molecular Formula | C8H11Cl3N2O |
| Molecular Weight | 257.55 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | 2,6-dichloro-4-[(1R)-1,2-diaminoethyl]phenol;hydrochloride |
| SMILES | Cl.NC[C@H](N)c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C8H10Cl2N2O.ClH/c9-5-1-4(7(12)3-11)2-6(10)8(5)13;/h1-2,7,13H,3,11-12H2;1H/t7-;/m0./s1 |
| InChIKey | ISTMQKFCRNCNMS-FJXQXJEOSA-N |
| XLogP | 2.08 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.55 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |