C10H16N2O — CID 66516147
4-[(1R)-1,2-diaminoethyl]-2,6-dimethylphenol (PubChem CID 66516147) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-[(1R)-1,2-diaminoethyl]-2,6-dimethylphenol.
| Compound Name | 4-[(1R)-1,2-diaminoethyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 66516147 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 4-[(1R)-1,2-diaminoethyl]-2,6-dimethylphenol |
| SMILES | Cc1cc([C@@H](N)CN)cc(C)c1O |
| InChI | InChI=1S/C10H16N2O/c1-6-3-8(9(12)5-11)4-7(2)10(6)13/h3-4,9,13H,5,11-12H2,1-2H3/t9-/m0/s1 |
| InChIKey | DQGSIBONKALUCZ-VIFPVBQESA-N |
| XLogP | 0.97 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |