C9H13IN2O — CID 131026853
2-[(1S)-1,2-diaminoethyl]-4-iodo-6-methylphenol (PubChem CID 131026853) has the molecular formula C9H13IN2O and a molecular weight of 292.12 g/mol. Its IUPAC name is 2-[(1S)-1,2-diaminoethyl]-4-iodo-6-methylphenol.
| Compound Name | 2-[(1S)-1,2-diaminoethyl]-4-iodo-6-methylphenol |
|---|---|
| PubChem CID | 131026853 |
| Molecular Formula | C9H13IN2O |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 2-[(1S)-1,2-diaminoethyl]-4-iodo-6-methylphenol |
| SMILES | Cc1cc(I)cc([C@H](N)CN)c1O |
| InChI | InChI=1S/C9H13IN2O/c1-5-2-6(10)3-7(9(5)13)8(12)4-11/h2-3,8,13H,4,11-12H2,1H3/t8-/m1/s1 |
| InChIKey | YEWOUPLRLXPKNW-MRVPVSSYSA-N |
| XLogP | 1.26 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|