C9H15ClN2O — CID 171212487
2-[(1S)-1,2-diaminoethyl]-6-methylphenol;hydrochloride (PubChem CID 171212487) has the molecular formula C9H15ClN2O and a molecular weight of 202.69 g/mol. Its IUPAC name is 2-[(1S)-1,2-diaminoethyl]-6-methylphenol;hydrochloride.
| Compound Name | 2-[(1S)-1,2-diaminoethyl]-6-methylphenol;hydrochloride |
|---|---|
| PubChem CID | 171212487 |
| Molecular Formula | C9H15ClN2O |
| Molecular Weight | 202.69 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 2-[(1S)-1,2-diaminoethyl]-6-methylphenol;hydrochloride |
| SMILES | Cc1cccc([C@H](N)CN)c1O.Cl |
| InChI | InChI=1S/C9H14N2O.ClH/c1-6-3-2-4-7(9(6)12)8(11)5-10;/h2-4,8,12H,5,10-11H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | RENLGSQRSRDNDY-DDWIOCJRSA-N |
| XLogP | 1.08 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.69 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|