C10H16N2O — CID 66516119
2-[(1R)-1,2-diaminoethyl]-6-ethylphenol (PubChem CID 66516119) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-[(1R)-1,2-diaminoethyl]-6-ethylphenol.
| Compound Name | 2-[(1R)-1,2-diaminoethyl]-6-ethylphenol |
|---|---|
| PubChem CID | 66516119 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-[(1R)-1,2-diaminoethyl]-6-ethylphenol |
| SMILES | CCc1cccc([C@@H](N)CN)c1O |
| InChI | InChI=1S/C10H16N2O/c1-2-7-4-3-5-8(10(7)13)9(12)6-11/h3-5,9,13H,2,6,11-12H2,1H3/t9-/m0/s1 |
| InChIKey | YFQUODQTWMVLNZ-VIFPVBQESA-N |
| XLogP | 0.91 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|