C11H18N2O — CID 171257230
2-[(1R)-1,3-diaminopropyl]-6-ethylphenol (PubChem CID 171257230) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-[(1R)-1,3-diaminopropyl]-6-ethylphenol.
| Compound Name | 2-[(1R)-1,3-diaminopropyl]-6-ethylphenol |
|---|---|
| PubChem CID | 171257230 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2-[(1R)-1,3-diaminopropyl]-6-ethylphenol |
| SMILES | CCc1cccc([C@H](N)CCN)c1O |
| InChI | InChI=1S/C11H18N2O/c1-2-8-4-3-5-9(11(8)14)10(13)6-7-12/h3-5,10,14H,2,6-7,12-13H2,1H3/t10-/m1/s1 |
| InChIKey | ULJXKUXPAFUODD-SNVBAGLBSA-N |
| XLogP | 1.30 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|