C9H11F3N2O — CID 66517650
2-[(1S)-1,2-diaminoethyl]-6-(trifluoromethyl)phenol (PubChem CID 66517650) has the molecular formula C9H11F3N2O and a molecular weight of 220.19 g/mol. Its IUPAC name is 2-[(1S)-1,2-diaminoethyl]-6-(trifluoromethyl)phenol.
| Compound Name | 2-[(1S)-1,2-diaminoethyl]-6-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 66517650 |
| Molecular Formula | C9H11F3N2O |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-[(1S)-1,2-diaminoethyl]-6-(trifluoromethyl)phenol |
| SMILES | NC[C@@H](N)c1cccc(C(F)(F)F)c1O |
| InChI | InChI=1S/C9H11F3N2O/c10-9(11,12)6-3-1-2-5(8(6)15)7(14)4-13/h1-3,7,15H,4,13-14H2/t7-/m1/s1 |
| InChIKey | OXPKDXJTWFBVPN-SSDOTTSWSA-N |
| XLogP | 1.37 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|