C9H10F3NO — CID 66514163
(2S)-2-amino-2-[2-(trifluoromethyl)phenyl]ethanol (PubChem CID 66514163) has the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. Its IUPAC name is (2S)-2-amino-2-[2-(trifluoromethyl)phenyl]ethanol.
| Compound Name | (2S)-2-amino-2-[2-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 66514163 |
| Molecular Formula | C9H10F3NO |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | (2S)-2-amino-2-[2-(trifluoromethyl)phenyl]ethanol |
| SMILES | N[C@H](CO)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C9H10F3NO/c10-9(11,12)7-4-2-1-3-6(7)8(13)5-14/h1-4,8,14H,5,13H2/t8-/m1/s1 |
| InChIKey | OIRSHTSIVLNGMS-MRVPVSSYSA-N |
| XLogP | 1.70 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |