C13H18F3NOS — CID 107525319
3-[2-amino-2-[2-(trifluoromethyl)phenyl]ethyl]sulfanyl-2-methylpropan-1-ol (PubChem CID 107525319) has the molecular formula C13H18F3NOS and a molecular weight of 293.35 g/mol. Its IUPAC name is 3-[2-amino-2-[2-(trifluoromethyl)phenyl]ethyl]sulfanyl-2-methylpropan-1-ol.
| Compound Name | 3-[2-amino-2-[2-(trifluoromethyl)phenyl]ethyl]sulfanyl-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 107525319 |
| Molecular Formula | C13H18F3NOS |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 3-[2-amino-2-[2-(trifluoromethyl)phenyl]ethyl]sulfanyl-2-methylpropan-1-ol |
| SMILES | CC(CO)CSCC(N)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H18F3NOS/c1-9(6-18)7-19-8-12(17)10-4-2-3-5-11(10)13(14,15)16/h2-5,9,12,18H,6-8,17H2,1H3 |
| InChIKey | QDPRVDOGYAYGGD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |