C12H16F3NO2 — CID 65310633
2-[1-[2-(trifluoromethyl)phenyl]ethylamino]propane-1,3-diol (PubChem CID 65310633) has the molecular formula C12H16F3NO2 and a molecular weight of 263.26 g/mol. Its IUPAC name is 2-[1-[2-(trifluoromethyl)phenyl]ethylamino]propane-1,3-diol.
| Compound Name | 2-[1-[2-(trifluoromethyl)phenyl]ethylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 65310633 |
| Molecular Formula | C12H16F3NO2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2-[1-[2-(trifluoromethyl)phenyl]ethylamino]propane-1,3-diol |
| SMILES | CC(NC(CO)CO)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H16F3NO2/c1-8(16-9(6-17)7-18)10-4-2-3-5-11(10)12(13,14)15/h2-5,8-9,16-18H,6-7H2,1H3 |
| InChIKey | ZGGVPDZAJLVHJE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |