C14H20F3NOS — CID 115893114
4-methylsulfinyl-N-[1-[2-(trifluoromethyl)phenyl]ethyl]butan-2-amine (PubChem CID 115893114) has the molecular formula C14H20F3NOS and a molecular weight of 307.38 g/mol. Its IUPAC name is 4-methylsulfinyl-N-[1-[2-(trifluoromethyl)phenyl]ethyl]butan-2-amine.
| Compound Name | 4-methylsulfinyl-N-[1-[2-(trifluoromethyl)phenyl]ethyl]butan-2-amine |
|---|---|
| PubChem CID | 115893114 |
| Molecular Formula | C14H20F3NOS |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 4-methylsulfinyl-N-[1-[2-(trifluoromethyl)phenyl]ethyl]butan-2-amine |
| SMILES | CC(CCS(C)=O)NC(C)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H20F3NOS/c1-10(8-9-20(3)19)18-11(2)12-6-4-5-7-13(12)14(15,16)17/h4-7,10-11,18H,8-9H2,1-3H3 |
| InChIKey | PAPSUMIPXMWUFV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |