C16H20F3N — CID 43111630
N-(dicyclopropylmethyl)-1-[2-(trifluoromethyl)phenyl]ethanamine (PubChem CID 43111630) has the molecular formula C16H20F3N and a molecular weight of 283.34 g/mol. Its IUPAC name is N-(dicyclopropylmethyl)-1-[2-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | N-(dicyclopropylmethyl)-1-[2-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 43111630 |
| Molecular Formula | C16H20F3N |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-(dicyclopropylmethyl)-1-[2-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CC(NC(C1CC1)C1CC1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H20F3N/c1-10(20-15(11-6-7-11)12-8-9-12)13-4-2-3-5-14(13)16(17,18)19/h2-5,10-12,15,20H,6-9H2,1H3 |
| InChIKey | PTHFTESJMWYOMO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |