C13H17ClF3N — CID 171226251
(S)-cyclopentyl-[2-(trifluoromethyl)phenyl]methanamine;hydrochloride (PubChem CID 171226251) has the molecular formula C13H17ClF3N and a molecular weight of 279.73 g/mol. Its IUPAC name is (S)-cyclopentyl-[2-(trifluoromethyl)phenyl]methanamine;hydrochloride.
| Compound Name | (S)-cyclopentyl-[2-(trifluoromethyl)phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 171226251 |
| Molecular Formula | C13H17ClF3N |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | (S)-cyclopentyl-[2-(trifluoromethyl)phenyl]methanamine;hydrochloride |
| SMILES | Cl.N[C@H](c1ccccc1C(F)(F)F)C1CCCC1 |
| InChI | InChI=1S/C13H16F3N.ClH/c14-13(15,16)11-8-4-3-7-10(11)12(17)9-5-1-2-6-9;/h3-4,7-9,12H,1-2,5-6,17H2;1H/t12-;/m0./s1 |
| InChIKey | BMAMOFQOLFITAV-YDALLXLXSA-N |
| XLogP | 4.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |