C15H17F6N — CID 171229858
(S)-[2,4-bis(trifluoromethyl)phenyl]-cyclohexylmethanamine (PubChem CID 171229858) has the molecular formula C15H17F6N and a molecular weight of 325.30 g/mol. Its IUPAC name is (S)-[2,4-bis(trifluoromethyl)phenyl]-cyclohexylmethanamine.
| Compound Name | (S)-[2,4-bis(trifluoromethyl)phenyl]-cyclohexylmethanamine |
|---|---|
| PubChem CID | 171229858 |
| Molecular Formula | C15H17F6N |
| Molecular Weight | 325.30 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (S)-[2,4-bis(trifluoromethyl)phenyl]-cyclohexylmethanamine |
| SMILES | N[C@H](c1ccc(C(F)(F)F)cc1C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C15H17F6N/c16-14(17,18)10-6-7-11(12(8-10)15(19,20)21)13(22)9-4-2-1-3-5-9/h6-9,13H,1-5,22H2/t13-/m0/s1 |
| InChIKey | CQJBILWTYINPIM-ZDUSSCGKSA-N |
| XLogP | 5.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.30 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |