C13H18F3NOS — CID 95975680
(2S)-4-[(R)-methylsulfinyl]-N-[[2-(trifluoromethyl)phenyl]methyl]butan-2-amine (PubChem CID 95975680) has the molecular formula C13H18F3NOS and a molecular weight of 293.35 g/mol. Its IUPAC name is (2S)-4-[(R)-methylsulfinyl]-N-[[2-(trifluoromethyl)phenyl]methyl]butan-2-amine.
| Compound Name | (2S)-4-[(R)-methylsulfinyl]-N-[[2-(trifluoromethyl)phenyl]methyl]butan-2-amine |
|---|---|
| PubChem CID | 95975680 |
| Molecular Formula | C13H18F3NOS |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (2S)-4-[(R)-methylsulfinyl]-N-[[2-(trifluoromethyl)phenyl]methyl]butan-2-amine |
| SMILES | C[C@@H](CC[S@@](C)=O)NCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H18F3NOS/c1-10(7-8-19(2)18)17-9-11-5-3-4-6-12(11)13(14,15)16/h3-6,10,17H,7-9H2,1-2H3/t10-,19+/m0/s1 |
| InChIKey | AYMORIRDTGNWQU-APBUJDDRSA-N |
| XLogP | 2.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |