C12H17F2NOS — CID 115768175
N-[(3,5-difluorophenyl)methyl]-4-methylsulfinylbutan-2-amine (PubChem CID 115768175) has the molecular formula C12H17F2NOS and a molecular weight of 261.34 g/mol. Its IUPAC name is N-[(3,5-difluorophenyl)methyl]-4-methylsulfinylbutan-2-amine.
| Compound Name | N-[(3,5-difluorophenyl)methyl]-4-methylsulfinylbutan-2-amine |
|---|---|
| PubChem CID | 115768175 |
| Molecular Formula | C12H17F2NOS |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | N-[(3,5-difluorophenyl)methyl]-4-methylsulfinylbutan-2-amine |
| SMILES | CC(CCS(C)=O)NCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H17F2NOS/c1-9(3-4-17(2)16)15-8-10-5-11(13)7-12(14)6-10/h5-7,9,15H,3-4,8H2,1-2H3 |
| InChIKey | ZDRBIYMGMZXONS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |