C13H21NOS — CID 115688195
N-[(3-methylphenyl)methyl]-4-methylsulfinylbutan-2-amine (PubChem CID 115688195) has the molecular formula C13H21NOS and a molecular weight of 239.38 g/mol. Its IUPAC name is N-[(3-methylphenyl)methyl]-4-methylsulfinylbutan-2-amine.
| Compound Name | N-[(3-methylphenyl)methyl]-4-methylsulfinylbutan-2-amine |
|---|---|
| PubChem CID | 115688195 |
| Molecular Formula | C13H21NOS |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N-[(3-methylphenyl)methyl]-4-methylsulfinylbutan-2-amine |
| SMILES | Cc1cccc(CNC(C)CCS(C)=O)c1 |
| InChI | InChI=1S/C13H21NOS/c1-11-5-4-6-13(9-11)10-14-12(2)7-8-16(3)15/h4-6,9,12,14H,7-8,10H2,1-3H3 |
| InChIKey | UIAAHDLQHNQVKV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |