C15H20F3NO2 — CID 43452194
methyl (2S)-3-methyl-2-[1-[2-(trifluoromethyl)phenyl]ethylamino]butanoate (PubChem CID 43452194) has the molecular formula C15H20F3NO2 and a molecular weight of 303.32 g/mol. Its IUPAC name is methyl (2S)-3-methyl-2-[1-[2-(trifluoromethyl)phenyl]ethylamino]butanoate.
| Compound Name | methyl (2S)-3-methyl-2-[1-[2-(trifluoromethyl)phenyl]ethylamino]butanoate |
|---|---|
| PubChem CID | 43452194 |
| Molecular Formula | C15H20F3NO2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | methyl (2S)-3-methyl-2-[1-[2-(trifluoromethyl)phenyl]ethylamino]butanoate |
| SMILES | COC(=O)[C@@H](NC(C)c1ccccc1C(F)(F)F)C(C)C |
| InChI | InChI=1S/C15H20F3NO2/c1-9(2)13(14(20)21-4)19-10(3)11-7-5-6-8-12(11)15(16,17)18/h5-10,13,19H,1-4H3/t10?,13-/m0/s1 |
| InChIKey | YUZPKLVCSMGHGV-HQVZTVAUSA-N |
| XLogP | 3.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |