C12H14F3N — CID 171206682
(1R)-3-methyl-1-[2-(trifluoromethyl)phenyl]but-3-en-1-amine (PubChem CID 171206682) has the molecular formula C12H14F3N and a molecular weight of 229.25 g/mol. Its IUPAC name is (1R)-3-methyl-1-[2-(trifluoromethyl)phenyl]but-3-en-1-amine.
| Compound Name | (1R)-3-methyl-1-[2-(trifluoromethyl)phenyl]but-3-en-1-amine |
|---|---|
| PubChem CID | 171206682 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | (1R)-3-methyl-1-[2-(trifluoromethyl)phenyl]but-3-en-1-amine |
| SMILES | C=C(C)C[C@@H](N)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H14F3N/c1-8(2)7-11(16)9-5-3-4-6-10(9)12(13,14)15/h3-6,11H,1,7,16H2,2H3/t11-/m1/s1 |
| InChIKey | VWTAUMWPXYLQQZ-LLVKDONJSA-N |
| XLogP | 3.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|