C12H14F3NO2 — CID 29059632
ethyl (3R)-3-amino-3-[2-(trifluoromethyl)phenyl]propanoate (PubChem CID 29059632) has the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. Its IUPAC name is ethyl (3R)-3-amino-3-[2-(trifluoromethyl)phenyl]propanoate.
| Compound Name | ethyl (3R)-3-amino-3-[2-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 29059632 |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | ethyl (3R)-3-amino-3-[2-(trifluoromethyl)phenyl]propanoate |
| SMILES | CCOC(=O)C[C@@H](N)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H14F3NO2/c1-2-18-11(17)7-10(16)8-5-3-4-6-9(8)12(13,14)15/h3-6,10H,2,7,16H2,1H3/t10-/m1/s1 |
| InChIKey | QCNMYIHWFNSXSO-SNVBAGLBSA-N |
| XLogP | 2.66 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |