C12H13F3O4 — CID 171866347
ethyl 2,3-dihydroxy-3-[2-(trifluoromethyl)phenyl]propanoate (PubChem CID 171866347) has the molecular formula C12H13F3O4 and a molecular weight of 278.23 g/mol. Its IUPAC name is ethyl 2,3-dihydroxy-3-[2-(trifluoromethyl)phenyl]propanoate.
| Compound Name | ethyl 2,3-dihydroxy-3-[2-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 171866347 |
| Molecular Formula | C12H13F3O4 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | ethyl 2,3-dihydroxy-3-[2-(trifluoromethyl)phenyl]propanoate |
| SMILES | CCOC(=O)C(O)C(O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H13F3O4/c1-2-19-11(18)10(17)9(16)7-5-3-4-6-8(7)12(13,14)15/h3-6,9-10,16-17H,2H2,1H3 |
| InChIKey | LKQOLGNRBIFXGA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |