C12H12F3NO6 — CID 171867064
ethyl 2,3-dihydroxy-3-[5-nitro-2-(trifluoromethyl)phenyl]propanoate (PubChem CID 171867064) has the molecular formula C12H12F3NO6 and a molecular weight of 323.22 g/mol. Its IUPAC name is ethyl 2,3-dihydroxy-3-[5-nitro-2-(trifluoromethyl)phenyl]propanoate.
| Compound Name | ethyl 2,3-dihydroxy-3-[5-nitro-2-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 171867064 |
| Molecular Formula | C12H12F3NO6 |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | ethyl 2,3-dihydroxy-3-[5-nitro-2-(trifluoromethyl)phenyl]propanoate |
| SMILES | CCOC(=O)C(O)C(O)c1cc([N+](=O)[O-])ccc1C(F)(F)F |
| InChI | InChI=1S/C12H12F3NO6/c1-2-22-11(19)10(18)9(17)7-5-6(16(20)21)3-4-8(7)12(13,14)15/h3-5,9-10,17-18H,2H2,1H3 |
| InChIKey | XKNCSJABDREUQQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|