C13H17NO7 — CID 171867034
ethyl 3-(2-ethoxy-5-nitrophenyl)-2,3-dihydroxypropanoate (PubChem CID 171867034) has the molecular formula C13H17NO7 and a molecular weight of 299.28 g/mol. Its IUPAC name is ethyl 3-(2-ethoxy-5-nitrophenyl)-2,3-dihydroxypropanoate.
| Compound Name | ethyl 3-(2-ethoxy-5-nitrophenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171867034 |
| Molecular Formula | C13H17NO7 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | ethyl 3-(2-ethoxy-5-nitrophenyl)-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)C(O)C(O)c1cc([N+](=O)[O-])ccc1OCC |
| InChI | InChI=1S/C13H17NO7/c1-3-20-10-6-5-8(14(18)19)7-9(10)11(15)12(16)13(17)21-4-2/h5-7,11-12,15-16H,3-4H2,1-2H3 |
| InChIKey | GDBJBHBGIARMEZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|