C17H26N2O7 — CID 171885777
tert-butyl N-[4-(2-ethoxy-5-nitrophenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171885777) has the molecular formula C17H26N2O7 and a molecular weight of 370.40 g/mol. Its IUPAC name is tert-butyl N-[4-(2-ethoxy-5-nitrophenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-ethoxy-5-nitrophenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171885777 |
| Molecular Formula | C17H26N2O7 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | tert-butyl N-[4-(2-ethoxy-5-nitrophenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | CCOc1ccc([N+](=O)[O-])cc1C(O)C(O)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H26N2O7/c1-5-25-14-7-6-11(19(23)24)10-12(14)15(21)13(20)8-9-18-16(22)26-17(2,3)4/h6-7,10,13,15,20-21H,5,8-9H2,1-4H3,(H,18,22) |
| InChIKey | MMJZOWWJBWTHGO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|