C16H21N3O6 — CID 171885483
tert-butyl N-[4-(2-cyano-4-nitrophenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171885483) has the molecular formula C16H21N3O6 and a molecular weight of 351.36 g/mol. Its IUPAC name is tert-butyl N-[4-(2-cyano-4-nitrophenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-cyano-4-nitrophenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171885483 |
| Molecular Formula | C16H21N3O6 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | tert-butyl N-[4-(2-cyano-4-nitrophenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(O)C(O)c1ccc([N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C16H21N3O6/c1-16(2,3)25-15(22)18-7-6-13(20)14(21)12-5-4-11(19(23)24)8-10(12)9-17/h4-5,8,13-14,20-21H,6-7H2,1-3H3,(H,18,22) |
| InChIKey | XMYHMLYOFFWSIT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 145.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|