C17H24N2O4 — CID 171884905
tert-butyl N-[4-(2-cyano-4-methylphenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171884905) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is tert-butyl N-[4-(2-cyano-4-methylphenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-cyano-4-methylphenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171884905 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | tert-butyl N-[4-(2-cyano-4-methylphenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | Cc1ccc(C(O)C(O)CCNC(=O)OC(C)(C)C)c(C#N)c1 |
| InChI | InChI=1S/C17H24N2O4/c1-11-5-6-13(12(9-11)10-18)15(21)14(20)7-8-19-16(22)23-17(2,3)4/h5-6,9,14-15,20-21H,7-8H2,1-4H3,(H,19,22) |
| InChIKey | ZZLCMQCBXCPRGH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |