C15H19N3O6 — CID 170832751
tert-butyl N-[3-(4-cyano-2-nitrophenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170832751) has the molecular formula C15H19N3O6 and a molecular weight of 337.33 g/mol. Its IUPAC name is tert-butyl N-[3-(4-cyano-2-nitrophenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-cyano-2-nitrophenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170832751 |
| Molecular Formula | C15H19N3O6 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | tert-butyl N-[3-(4-cyano-2-nitrophenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)C(O)c1ccc(C#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H19N3O6/c1-15(2,3)24-14(21)17-8-12(19)13(20)10-5-4-9(7-16)6-11(10)18(22)23/h4-6,12-13,19-20H,8H2,1-3H3,(H,17,21) |
| InChIKey | VLNKJILKLNKDHM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 145.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|