C15H22N2O7 — CID 170832829
tert-butyl N-[2,3-dihydroxy-3-[4-(hydroxymethyl)-3-nitrophenyl]propyl]carbamate (PubChem CID 170832829) has the molecular formula C15H22N2O7 and a molecular weight of 342.35 g/mol. Its IUPAC name is tert-butyl N-[2,3-dihydroxy-3-[4-(hydroxymethyl)-3-nitrophenyl]propyl]carbamate.
| Compound Name | tert-butyl N-[2,3-dihydroxy-3-[4-(hydroxymethyl)-3-nitrophenyl]propyl]carbamate |
|---|---|
| PubChem CID | 170832829 |
| Molecular Formula | C15H22N2O7 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | tert-butyl N-[2,3-dihydroxy-3-[4-(hydroxymethyl)-3-nitrophenyl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)C(O)c1ccc(CO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H22N2O7/c1-15(2,3)24-14(21)16-7-12(19)13(20)9-4-5-10(8-18)11(6-9)17(22)23/h4-6,12-13,18-20H,7-8H2,1-3H3,(H,16,21) |
| InChIKey | MFRPZJRNXVJGNV-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 142.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|