C17H24N2O8 — CID 171885800
2-[4-[1,2-dihydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-2-nitrophenyl]acetic acid (PubChem CID 171885800) has the molecular formula C17H24N2O8 and a molecular weight of 384.39 g/mol. Its IUPAC name is 2-[4-[1,2-dihydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-2-nitrophenyl]acetic acid.
| Compound Name | 2-[4-[1,2-dihydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-2-nitrophenyl]acetic acid |
|---|---|
| PubChem CID | 171885800 |
| Molecular Formula | C17H24N2O8 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-[4-[1,2-dihydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-2-nitrophenyl]acetic acid |
| SMILES | CC(C)(C)OC(=O)NCCC(O)C(O)c1ccc(CC(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H24N2O8/c1-17(2,3)27-16(24)18-7-6-13(20)15(23)11-5-4-10(9-14(21)22)12(8-11)19(25)26/h4-5,8,13,15,20,23H,6-7,9H2,1-3H3,(H,18,24)(H,21,22) |
| InChIKey | NBWKGRUEWYIUDV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 159.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|