C14H21N3O7 — CID 171885240
tert-butyl N-[3,4-dihydroxy-4-(5-nitro-6-oxo-1H-pyridin-3-yl)butyl]carbamate (PubChem CID 171885240) has the molecular formula C14H21N3O7 and a molecular weight of 343.34 g/mol. Its IUPAC name is tert-butyl N-[3,4-dihydroxy-4-(5-nitro-6-oxo-1H-pyridin-3-yl)butyl]carbamate.
| Compound Name | tert-butyl N-[3,4-dihydroxy-4-(5-nitro-6-oxo-1H-pyridin-3-yl)butyl]carbamate |
|---|---|
| PubChem CID | 171885240 |
| Molecular Formula | C14H21N3O7 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | tert-butyl N-[3,4-dihydroxy-4-(5-nitro-6-oxo-1H-pyridin-3-yl)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(O)C(O)c1c[nH]c(=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H21N3O7/c1-14(2,3)24-13(21)15-5-4-10(18)11(19)8-6-9(17(22)23)12(20)16-7-8/h6-7,10-11,18-19H,4-5H2,1-3H3,(H,15,21)(H,16,20) |
| InChIKey | SPTPLPZXJDRZFH-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 154.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|