C14H22N2O5 — CID 171884346
tert-butyl N-[3,4-dihydroxy-4-(4-oxo-1H-pyridin-2-yl)butyl]carbamate (PubChem CID 171884346) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is tert-butyl N-[3,4-dihydroxy-4-(4-oxo-1H-pyridin-2-yl)butyl]carbamate.
| Compound Name | tert-butyl N-[3,4-dihydroxy-4-(4-oxo-1H-pyridin-2-yl)butyl]carbamate |
|---|---|
| PubChem CID | 171884346 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | tert-butyl N-[3,4-dihydroxy-4-(4-oxo-1H-pyridin-2-yl)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(O)C(O)c1cc(=O)cc[nH]1 |
| InChI | InChI=1S/C14H22N2O5/c1-14(2,3)21-13(20)16-7-5-11(18)12(19)10-8-9(17)4-6-15-10/h4,6,8,11-12,18-19H,5,7H2,1-3H3,(H,15,17)(H,16,20) |
| InChIKey | JLSNOHKHWNORSF-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |